CAS 186829-19-6 is the registry number for CMV-423. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide (CAS 186829-19-6) is a chemical compound with the molecular formula C14H14ClN3O and a molecular weight of 275.73 g/mol. IUPAC name: 2-chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide. InChIKey: KNGXENHWYNLKBU-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 2-chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide |
| InChIKey | KNGXENHWYNLKBU-UHFFFAOYSA-N |
| SMILES | C1CCN2C(=C(C(=C2C3=CN=CC=C3)Cl)C(=O)N)C1 |
Computed by PubChem (NCBI)