CAS 1869125-13-2 appears in our catalog under these names: 2,4-Dichloro-6-(1H-pyrazol-1-yl)pyrimidine, 97%, 97%, 2,4-DICHLORO-6-(1H-PYRAZOL-1-YL)PYRIMIDINE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2,4-dichloro-6-pyrazol-1-ylpyrimidine (CAS 1869125-13-2) is a chemical compound with the molecular formula C7H4Cl2N4 and a molecular weight of 215.04 g/mol. IUPAC name: 2,4-dichloro-6-pyrazol-1-ylpyrimidine. InChIKey: LZHMCVBSSQESRX-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N4 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | 2,4-dichloro-6-pyrazol-1-ylpyrimidine |
| InChIKey | LZHMCVBSSQESRX-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)