CAS 41421-27-6 is the registry number for 5-(3,4-Dichlorophenyl)-1H-tetrazole. Offered by: Biosynth. Available pack sizes: 2,5g.
5-(3,4-dichlorophenyl)-2H-tetrazole (CAS 41421-27-6) is a chemical compound with the molecular formula C7H4Cl2N4 and a molecular weight of 215.04 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-2H-tetrazole. InChIKey: SPKVZXBNWCKHGR-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N4 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-2H-tetrazole |
| InChIKey | SPKVZXBNWCKHGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NNN=N2)Cl)Cl |
Computed by PubChem (NCBI)