CAS 50907-22-7 is the registry number for 5-(2,4-Dichlorophenyl)-1H-tetrazole, 95%. Offered by: AmBeed. Available pack sizes: 25g.
5-(2,4-dichlorophenyl)-2H-tetrazole (CAS 50907-22-7) is a chemical compound with the molecular formula C7H4Cl2N4 and a molecular weight of 215.04 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-2H-tetrazole. InChIKey: DPHDYJRNGBXYQG-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N4 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-2H-tetrazole |
| InChIKey | DPHDYJRNGBXYQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NNN=N2 |
Computed by PubChem (NCBI)