CAS 92712-49-7 is the registry number for 5-(3,5-Dichlorophenyl)-2H-tetrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 250mg, 1g.
5-(3,5-dichlorophenyl)-2H-tetrazole (CAS 92712-49-7) is a chemical compound with the molecular formula C7H4Cl2N4 and a molecular weight of 215.04 g/mol. IUPAC name: 5-(3,5-dichlorophenyl)-2H-tetrazole. InChIKey: VCYMSAGOTYBIHM-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N4 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | 5-(3,5-dichlorophenyl)-2H-tetrazole |
| InChIKey | VCYMSAGOTYBIHM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NNN=N2 |
Computed by PubChem (NCBI)