CAS 187218-03-7 appears in our catalog under these names: (R)-2-Tetrahydroisoquinoline acetic acid hydrochloride, 95%, H-D-Tqa-OH, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]acetic acid;hydrochloride (CAS 187218-03-7) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 2-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]acetic acid;hydrochloride. InChIKey: SWYPWAIQEURSFY-HNCPQSOCSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]acetic acid;hydrochloride |
| InChIKey | SWYPWAIQEURSFY-HNCPQSOCSA-N |
| SMILES | C1[C@@H](NCC2=CC=CC=C21)CC(=O)O.Cl |
Computed by PubChem (NCBI)