CAS 187243-00-1 appears in our catalog under these names: 2-Chloro-3-nitro-5,6,7,8-tetrahydroquinoline, 97%, 2-Chloro-3-nitro-5,6,7,8-tetrahydroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-3-nitro-5,6,7,8-tetrahydroquinoline (CAS 187243-00-1) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 2-chloro-3-nitro-5,6,7,8-tetrahydroquinoline. InChIKey: ZKCCJTPLBDQLLO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-chloro-3-nitro-5,6,7,8-tetrahydroquinoline |
| InChIKey | ZKCCJTPLBDQLLO-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC(=C(C=C2C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)