CAS 187278-04-2 appears in our catalog under these names: 5-[(2-Bromo-phenylamino)-methylene]-2,2-dimethyl-[1,3]dioxane-4,6-dione, 95%, 5-(((2-Bromophenyl)amino)methylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
5-[(2-bromoanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 187278-04-2) is a chemical compound with the molecular formula C13H12BrNO4 and a molecular weight of 326.14 g/mol. IUPAC name: 5-[(2-bromoanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: CZIDPABFUHRFGR-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO4 |
|---|---|
| Molecular weight | 326.14 g/mol |
| IUPAC name | 5-[(2-bromoanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | CZIDPABFUHRFGR-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNC2=CC=CC=C2Br)C(=O)O1)C |
Computed by PubChem (NCBI)