Products 2504203-59-0
CAS 2504203-59-0 is the registry number for 2,5-Dioxopyrrolidin-1-yl 3-(3-bromophenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) 3-(3-bromophenyl)propanoate (CAS 2504203-59-0) is a chemical compound with the molecular formula C13H12BrNO4 and a molecular weight of 326.14 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-(3-bromophenyl)propanoate. InChIKey: FAHSTZLTMCAKRO-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO4 |
|---|---|
| Molecular weight | 326.14 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-(3-bromophenyl)propanoate |
| InChIKey | FAHSTZLTMCAKRO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)