CAS 909397-79-1 is the registry number for 3-Bromo-1-(3,4-dimethoxy-benzyl)-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-bromo-1-[(3,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione (CAS 909397-79-1) is a chemical compound with the molecular formula C13H12BrNO4 and a molecular weight of 326.14 g/mol. IUPAC name: 3-bromo-1-[(3,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione. InChIKey: XXTRLOWLLUTKDK-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO4 |
|---|---|
| Molecular weight | 326.14 g/mol |
| IUPAC name | 3-bromo-1-[(3,4-dimethoxyphenyl)methyl]pyrrole-2,5-dione |
| InChIKey | XXTRLOWLLUTKDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CN2C(=O)C=C(C2=O)Br)OC |
Computed by PubChem (NCBI)