Products 1983108-14-0
CAS 1983108-14-0 is the registry number for Methyl 3-bromo-4-[(2,5-dioxo-1-pyrrolidinyl)methyl]benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 3-bromo-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate (CAS 1983108-14-0) is a chemical compound with the molecular formula C13H12BrNO4 and a molecular weight of 326.14 g/mol. IUPAC name: methyl 3-bromo-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate. InChIKey: CXEKBECFJCBESV-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO4 |
|---|---|
| Molecular weight | 326.14 g/mol |
| IUPAC name | methyl 3-bromo-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate |
| InChIKey | CXEKBECFJCBESV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)CN2C(=O)CCC2=O)Br |
Computed by PubChem (NCBI)