Products 1874418-51-5
CAS 1874418-51-5 is the registry number for tert-butyl N-(4-bromo-2,5-difluorophenyl)carbamate, ≥99.6%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-(4-bromo-2,5-difluorophenyl)carbamate (CAS 1874418-51-5) is a chemical compound with the molecular formula C11H12BrF2NO2 and a molecular weight of 308.12 g/mol. IUPAC name: tert-butyl N-(4-bromo-2,5-difluorophenyl)carbamate. InChIKey: CNBFGLGIVIZNIJ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrF2NO2 |
|---|---|
| Molecular weight | 308.12 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-2,5-difluorophenyl)carbamate |
| InChIKey | CNBFGLGIVIZNIJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)