CAS 1875287-68-5 is the registry number for N-Benzyl-2-chloro-n,6-dimethylpyridine-4-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-benzyl-2-chloro-N,6-dimethylpyridine-4-carboxamide (CAS 1875287-68-5) is a chemical compound with the molecular formula C15H15ClN2O and a molecular weight of 274.74 g/mol. IUPAC name: N-benzyl-2-chloro-N,6-dimethylpyridine-4-carboxamide. InChIKey: HGXIOSJSSBYGTR-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | N-benzyl-2-chloro-N,6-dimethylpyridine-4-carboxamide |
| InChIKey | HGXIOSJSSBYGTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)Cl)C(=O)N(C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)