CAS 2279122-80-2 is the registry number for 5-Amino-4'-chloro-biphenyl-3-carboxylic acid ethylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-5-(4-chlorophenyl)-N-ethylbenzamide (CAS 2279122-80-2) is a chemical compound with the molecular formula C15H15ClN2O and a molecular weight of 274.74 g/mol. IUPAC name: 3-amino-5-(4-chlorophenyl)-N-ethylbenzamide. InChIKey: AMKZLZPXZAGUTB-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | 3-amino-5-(4-chlorophenyl)-N-ethylbenzamide |
| InChIKey | AMKZLZPXZAGUTB-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC(=CC(=C1)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)