CAS 268209-92-3 appears in our catalog under these names: (R,S)-1,3,4,5-Tetrahydro-5-phenyl-2h-1,4-benzodiazepin-2-one hydrochloride, 95%, (R,S)-1,3,4,5-Tetrahydro-5-phenyl-2H-1,4-benzodiazepin-2-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5000mg, 2000mg.
5-phenyl-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one;hydrochloride (CAS 268209-92-3) is a chemical compound with the molecular formula C15H15ClN2O and a molecular weight of 274.74 g/mol. IUPAC name: 5-phenyl-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one;hydrochloride. InChIKey: NCZSZNNACZSMIT-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | 5-phenyl-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one;hydrochloride |
| InChIKey | NCZSZNNACZSMIT-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC=CC=C2C(N1)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)