Products 2465-29-4
CAS 2465-29-4 is the registry number for Xanthylium, 3,6-bis(methylamino)-, chloride (1:1). Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl-[6-(methylamino)xanthen-3-ylidene]azanium chloride (CAS 2465-29-4) is a chemical compound with the molecular formula C15H15ClN2O and a molecular weight of 274.74 g/mol. IUPAC name: methyl-[6-(methylamino)xanthen-3-ylidene]azanium chloride. InChIKey: IVHDZUFNZLETBM-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O |
|---|---|
| Molecular weight | 274.74 g/mol |
| IUPAC name | methyl-[6-(methylamino)xanthen-3-ylidene]azanium chloride |
| InChIKey | IVHDZUFNZLETBM-UHFFFAOYSA-N |
| SMILES | CNC1=CC2=C(C=C1)C=C3C=CC(=[NH+]C)C=C3O2.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
ACRIDINE RED, Acridine Red 3B, Acridin Red, Acridine red, hydrochloride, Xanthylium, 3,6-bis(methylamino)-, chloride, Dimethyldiaminoxanthenyl chloride, 3,6-Bis(methylamino)xanthylium chloride, ACRIDINERED, 3H-Xanthen-6-amine, N-methyl-3-(methylimino)-, hydrochloride, 3H-Xanthen-6-amine, N-methyl-3-(methylimino)-, monohydrochloride