CAS 1876471-18-9 is the registry number for 8-Chloro-2-[(3R)-3-methyl-4-morpholinyl]-1,7-naphthyridin-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
8-chloro-2-[(3R)-3-methylmorpholin-4-yl]-1H-1,7-naphthyridin-4-one (CAS 1876471-18-9) is a chemical compound with the molecular formula C13H14ClN3O2 and a molecular weight of 279.72 g/mol. IUPAC name: 8-chloro-2-[(3R)-3-methylmorpholin-4-yl]-1H-1,7-naphthyridin-4-one. InChIKey: XIBNHELYULXSME-MRVPVSSYSA-N.
| Molecular formula | C13H14ClN3O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 8-chloro-2-[(3R)-3-methylmorpholin-4-yl]-1H-1,7-naphthyridin-4-one |
| InChIKey | XIBNHELYULXSME-MRVPVSSYSA-N |
| SMILES | C[C@@H]1COCCN1C2=CC(=O)C3=C(N2)C(=NC=C3)Cl |
Computed by PubChem (NCBI)