Products 1877185-94-8
CAS 1877185-94-8 is the registry number for 1-(1,3-Benzothiazol-2-yl)cyclopentanecarbonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(1,3-benzothiazol-2-yl)cyclopentane-1-carbonitrile (CAS 1877185-94-8) is a chemical compound with the molecular formula C13H12N2S and a molecular weight of 228.31 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)cyclopentane-1-carbonitrile. InChIKey: GZSGVFMZYARUKL-UHFFFAOYSA-N.
| Molecular formula | C13H12N2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)cyclopentane-1-carbonitrile |
| InChIKey | GZSGVFMZYARUKL-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C#N)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)