CAS 3898-08-6 appears in our catalog under these names: 1,1–Diphenyl–2–thiourea, N,N-Diphenylthiourea, >98.0%(HPLC)(T), 1,1-Diphenylthiourea 97%, 1,1-Diphenyl-2-propyn-1-ol, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
1,1-diphenylthiourea (CAS 3898-08-6) is a chemical compound with the molecular formula C13H12N2S and a molecular weight of 228.31 g/mol. IUPAC name: 1,1-diphenylthiourea. InChIKey: FPZXQVCYHDMIIA-UHFFFAOYSA-N.
| Molecular formula | C13H12N2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 1,1-diphenylthiourea |
| InChIKey | FPZXQVCYHDMIIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=S)N |
Computed by PubChem (NCBI)