CAS 29711-79-3 appears in our catalog under these names: 4-Dimethylamino-1-naphthyl isothiocyanate, 97%, 4-Dimethylamino-1-naphthylisothiocyanate, 98%, 4–Dimethylamino–1–naphthyl Isothiocyanate, 4-Dimethylamino-1-naphthyl Isothiocyanate [for HPLC Labeling], >98.0%(HPLC)(T), 4-Dimethylamino-1-naphthylisothiocyanate. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 200mg.
4-isothiocyanato-N,N-dimethylnaphthalen-1-amine (CAS 29711-79-3) is a chemical compound with the molecular formula C13H12N2S and a molecular weight of 228.31 g/mol. IUPAC name: 4-isothiocyanato-N,N-dimethylnaphthalen-1-amine. InChIKey: SMZHGTXTWIAKGS-UHFFFAOYSA-N.
| Molecular formula | C13H12N2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 4-isothiocyanato-N,N-dimethylnaphthalen-1-amine |
| InChIKey | SMZHGTXTWIAKGS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C2=CC=CC=C21)N=C=S |
Computed by PubChem (NCBI)