Products 519016-81-0
CAS 519016-81-0 is the registry number for 2-Amino-4-(2,5-dimethylphenyl)thiophene-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-amino-4-(2,5-dimethylphenyl)thiophene-3-carbonitrile (CAS 519016-81-0) is a chemical compound with the molecular formula C13H12N2S and a molecular weight of 228.31 g/mol. IUPAC name: 2-amino-4-(2,5-dimethylphenyl)thiophene-3-carbonitrile. InChIKey: YGAOADHWCFBYHS-UHFFFAOYSA-N.
| Molecular formula | C13H12N2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 2-amino-4-(2,5-dimethylphenyl)thiophene-3-carbonitrile |
| InChIKey | YGAOADHWCFBYHS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=CSC(=C2C#N)N |
Computed by PubChem (NCBI)