CAS 187805-51-2 appears in our catalog under these names: 6-Chloro-8-fluoroquinazolin-4(1H)-one, 95%, 95%, 6-chloro-8-fluoro-1,4-dihydroquinazolin-4-one, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-chloro-8-fluoro-3H-quinazolin-4-one (CAS 187805-51-2) is a chemical compound with the molecular formula C8H4ClFN2O and a molecular weight of 198.58 g/mol. IUPAC name: 6-chloro-8-fluoro-3H-quinazolin-4-one. InChIKey: XLGDIIQWJWFZSI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O |
|---|---|
| Molecular weight | 198.58 g/mol |
| IUPAC name | 6-chloro-8-fluoro-3H-quinazolin-4-one |
| InChIKey | XLGDIIQWJWFZSI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)NC=N2)F)Cl |
Computed by PubChem (NCBI)