CAS 1880896-28-5 is the registry number for 3-((1-(Hydroxymethyl)cyclopentyl)amino)thietane 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-[(1,1-dioxothietan-3-yl)amino]cyclopentyl]methanol (CAS 1880896-28-5) is a chemical compound with the molecular formula C9H17NO3S and a molecular weight of 219.30 g/mol. IUPAC name: [1-[(1,1-dioxothietan-3-yl)amino]cyclopentyl]methanol. InChIKey: LXKCMWPNPYCUEA-UHFFFAOYSA-N.
| Molecular formula | C9H17NO3S |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | [1-[(1,1-dioxothietan-3-yl)amino]cyclopentyl]methanol |
| InChIKey | LXKCMWPNPYCUEA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CO)NC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)