CAS 278788-74-2 appears in our catalog under these names: tert-Butyl thiomorpholine-4-carboxylate 1-oxide, 95%, tert-butyl thiomorpholine-4-carboxylate 1-oxide, tert-Butyl thiomorpholine-4-carboxylate 1-oxide, 98%, 98%, tert-Butyl thiomorpholine-4-carboxylate 1-oxide, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
Tert-butyl 1-oxo-1,4-thiazinane-4-carboxylate (CAS 278788-74-2) is a chemical compound with the molecular formula C9H17NO3S and a molecular weight of 219.30 g/mol. IUPAC name: tert-butyl 1-oxo-1,4-thiazinane-4-carboxylate. InChIKey: WCSAOXAANHXOPS-UHFFFAOYSA-N.
| Molecular formula | C9H17NO3S |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | tert-butyl 1-oxo-1,4-thiazinane-4-carboxylate |
| InChIKey | WCSAOXAANHXOPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)CC1 |
Computed by PubChem (NCBI)