CAS 950226-89-8 is the registry number for N-(1,1-Dioxidotetrahydrothiophen-3-yl)pivalamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothiolan-3-yl)-2,2-dimethylpropanamide (CAS 950226-89-8) is a chemical compound with the molecular formula C9H17NO3S and a molecular weight of 219.30 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-2,2-dimethylpropanamide. InChIKey: ZAZAPINYVFVVCL-UHFFFAOYSA-N.
| Molecular formula | C9H17NO3S |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)-2,2-dimethylpropanamide |
| InChIKey | ZAZAPINYVFVVCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)