Products 35136-87-9

CAS 35136-87-9 is the registry number for Retapamulin Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] methanesulfonate (CAS 35136-87-9) is a chemical compound with the molecular formula C9H17NO3S and a molecular weight of 219.30 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] methanesulfonate. InChIKey: JDDPSVBBPCQWAL-JVHMLUBASA-N.

Identity
Molecular formulaC9H17NO3S
Molecular weight219.30 g/mol
IUPAC name[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] methanesulfonate
InChIKeyJDDPSVBBPCQWAL-JVHMLUBASA-N
SMILESCN1[C@@H]2CC[C@H]1CC(C2)OS(=O)(=O)C

Computed by PubChem (NCBI)