CAS 35136-87-9 is the registry number for Retapamulin Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] methanesulfonate (CAS 35136-87-9) is a chemical compound with the molecular formula C9H17NO3S and a molecular weight of 219.30 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] methanesulfonate. InChIKey: JDDPSVBBPCQWAL-JVHMLUBASA-N.
| Molecular formula | C9H17NO3S |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] methanesulfonate |
| InChIKey | JDDPSVBBPCQWAL-JVHMLUBASA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OS(=O)(=O)C |
Computed by PubChem (NCBI)