CAS 1881270-49-0 appears in our catalog under these names: Nepafenac Impurity 3, Nepafenac Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
8-benzoyl-2,4-dihydro-1H-cinnolin-3-one (CAS 1881270-49-0) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 8-benzoyl-2,4-dihydro-1H-cinnolin-3-one. InChIKey: COSMGALUGGCMFZ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 8-benzoyl-2,4-dihydro-1H-cinnolin-3-one |
| InChIKey | COSMGALUGGCMFZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C(=O)C3=CC=CC=C3)NNC1=O |
Computed by PubChem (NCBI)