CAS 1272758-28-7 appears in our catalog under these names: Ethyl 2-amino-5-fluoro-2,3-dihydro-1h-indene-2-carboxylate hydrochloride, 95%, Ethyl 2-amino-5-fluoro-2,3-dihydro-1H-indene-2-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Ethyl 2-amino-5-fluoro-1,3-dihydroindene-2-carboxylate;hydrochloride (CAS 1272758-28-7) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: ethyl 2-amino-5-fluoro-1,3-dihydroindene-2-carboxylate;hydrochloride. InChIKey: PTWVTLFWGYWFPR-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO2 |
|---|---|
| Molecular weight | 259.70 g/mol |
| IUPAC name | ethyl 2-amino-5-fluoro-1,3-dihydroindene-2-carboxylate;hydrochloride |
| InChIKey | PTWVTLFWGYWFPR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC2=C(C1)C=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)