CAS 686766-31-4 is the registry number for (2S,4S)-4-(3-Fluorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 686766-31-4) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: (2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: UEJCKIYKRFAMOV-ROLPUNSJSA-N.
| Molecular formula | C12H15ClFNO2 |
|---|---|
| Molecular weight | 259.70 g/mol |
| IUPAC name | (2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | UEJCKIYKRFAMOV-ROLPUNSJSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)CC2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)