Products 2307552-72-1

CAS 2307552-72-1 is the registry number for 1-Benzyl-3-fluoropyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-benzyl-3-fluoropyrrolidine-3-carboxylic acid;hydrochloride (CAS 2307552-72-1) is a chemical compound with the molecular formula C12H15ClFNO2 and a molecular weight of 259.70 g/mol. IUPAC name: 1-benzyl-3-fluoropyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: UHNSSKDLZYQWOH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15ClFNO2
Molecular weight259.70 g/mol
IUPAC name1-benzyl-3-fluoropyrrolidine-3-carboxylic acid;hydrochloride
InChIKeyUHNSSKDLZYQWOH-UHFFFAOYSA-N
SMILESC1CN(CC1(C(=O)O)F)CC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)