CAS 1881980-41-1 appears in our catalog under these names: Benzyl 5-bromo-2-chloroisonicotinate, 95%, Benzyl 5-bromo-2-chloroisonicotinate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
Benzyl 5-bromo-2-chloropyridine-4-carboxylate (CAS 1881980-41-1) is a chemical compound with the molecular formula C13H9BrClNO2 and a molecular weight of 326.57 g/mol. IUPAC name: benzyl 5-bromo-2-chloropyridine-4-carboxylate. InChIKey: AGUKXSGPHZAGPO-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClNO2 |
|---|---|
| Molecular weight | 326.57 g/mol |
| IUPAC name | benzyl 5-bromo-2-chloropyridine-4-carboxylate |
| InChIKey | AGUKXSGPHZAGPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=NC=C2Br)Cl |
Computed by PubChem (NCBI)