CAS 2401894-52-6 is the registry number for 2-(4-Bromo-2-methylbenzo[d][1,3]dioxol-2-yl)-5-chloropyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromo-2-methyl-1,3-benzodioxol-2-yl)-5-chloropyridine (CAS 2401894-52-6) is a chemical compound with the molecular formula C13H9BrClNO2 and a molecular weight of 326.57 g/mol. IUPAC name: 2-(4-bromo-2-methyl-1,3-benzodioxol-2-yl)-5-chloropyridine. InChIKey: APKABHVDPKOXLN-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClNO2 |
|---|---|
| Molecular weight | 326.57 g/mol |
| IUPAC name | 2-(4-bromo-2-methyl-1,3-benzodioxol-2-yl)-5-chloropyridine |
| InChIKey | APKABHVDPKOXLN-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C(=CC=C2)Br)C3=NC=C(C=C3)Cl |
Computed by PubChem (NCBI)