CAS 2379321-79-4 is the registry number for Benzyl 3-bromo-2-chloroisonicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Benzyl 3-bromo-2-chloropyridine-4-carboxylate (CAS 2379321-79-4) is a chemical compound with the molecular formula C13H9BrClNO2 and a molecular weight of 326.57 g/mol. IUPAC name: benzyl 3-bromo-2-chloropyridine-4-carboxylate. InChIKey: WQZSIKJLKGILRP-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClNO2 |
|---|---|
| Molecular weight | 326.57 g/mol |
| IUPAC name | benzyl 3-bromo-2-chloropyridine-4-carboxylate |
| InChIKey | WQZSIKJLKGILRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=C(C(=NC=C2)Cl)Br |
Computed by PubChem (NCBI)