Products 320785-96-4
CAS 320785-96-4 is the registry number for N-(2-(2-Bromophenoxy)-5-chlorophenyl)formamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(2-bromophenoxy)-5-chlorophenyl]formamide (CAS 320785-96-4) is a chemical compound with the molecular formula C13H9BrClNO2 and a molecular weight of 326.57 g/mol. IUPAC name: N-[2-(2-bromophenoxy)-5-chlorophenyl]formamide. InChIKey: FOIKPEOZUGIBSR-UHFFFAOYSA-N.
| Molecular formula | C13H9BrClNO2 |
|---|---|
| Molecular weight | 326.57 g/mol |
| IUPAC name | N-[2-(2-bromophenoxy)-5-chlorophenyl]formamide |
| InChIKey | FOIKPEOZUGIBSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=C(C=C(C=C2)Cl)NC=O)Br |
Computed by PubChem (NCBI)