CAS 18823-63-7 appears in our catalog under these names: Lidocaine Impurity 48, 2,2-Dichloro-N-(2,3-dimethylphenyl)acetamide, 98%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
2,2-dichloro-N-(2,3-dimethylphenyl)acetamide (CAS 18823-63-7) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 2,2-dichloro-N-(2,3-dimethylphenyl)acetamide. InChIKey: USQDXPUFFLAJEB-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 2,2-dichloro-N-(2,3-dimethylphenyl)acetamide |
| InChIKey | USQDXPUFFLAJEB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(=O)C(Cl)Cl)C |
Computed by PubChem (NCBI)