Products 1882373-48-9
CAS 1882373-48-9 is the registry number for 4,6-Dibromochromane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dibromo-3,4-dihydro-2H-chromene (CAS 1882373-48-9) is a chemical compound with the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. IUPAC name: 4,6-dibromo-3,4-dihydro-2H-chromene. InChIKey: AZPYIVBTIWTMIM-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 4,6-dibromo-3,4-dihydro-2H-chromene |
| InChIKey | AZPYIVBTIWTMIM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1Br)C=C(C=C2)Br |
Computed by PubChem (NCBI)
Synonyms:
4,6-Dibromochromane, 4,6-dibromochroman