CAS 188297-95-2 is the registry number for 1,3,7-Trimethyluric Acid-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
1,3-dimethyl-7-(trideuteriomethyl)-9H-purine-2,6,8-trione (CAS 188297-95-2) is a chemical compound with the molecular formula C8H10N4O3 and a molecular weight of 213.21 g/mol. IUPAC name: 1,3-dimethyl-7-(trideuteriomethyl)-9H-purine-2,6,8-trione. InChIKey: BYXCFUMGEBZDDI-FIBGUPNXSA-N.
| Molecular formula | C8H10N4O3 |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 1,3-dimethyl-7-(trideuteriomethyl)-9H-purine-2,6,8-trione |
| InChIKey | BYXCFUMGEBZDDI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(NC1=O)N(C(=O)N(C2=O)C)C |
Computed by PubChem (NCBI)