CAS 18833-41-5 is the registry number for 3-Azatricyclo(7.3.1.0,5,13)trideca-1(12),5(13),6,8,10-pentaen-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3-dihydrobenzo[de]isoquinolin-1-one (CAS 18833-41-5) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 2,3-dihydrobenzo[de]isoquinolin-1-one. InChIKey: QGJHNXPHHOCUAH-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 2,3-dihydrobenzo[de]isoquinolin-1-one |
| InChIKey | QGJHNXPHHOCUAH-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC3=C2C(=CC=C3)C(=O)N1 |
Computed by PubChem (NCBI)