Products 1883425-90-8
CAS 1883425-90-8 appears in our catalog under these names: 3-(2-Methylpropyl)-1H-indazole-5-carboxylic acid, 3-(2-methylpropyl)-1H-indazole-5-carboxylic acid, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg.
3-(2-methylpropyl)-2H-indazole-5-carboxylic acid (CAS 1883425-90-8) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 3-(2-methylpropyl)-2H-indazole-5-carboxylic acid. InChIKey: SOIMDMPMUKPBOC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 3-(2-methylpropyl)-2H-indazole-5-carboxylic acid |
| InChIKey | SOIMDMPMUKPBOC-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=C2C=C(C=CC2=NN1)C(=O)O |
Computed by PubChem (NCBI)