CAS 18869-29-9 appears in our catalog under these names: 4,4'–Dimethyl–trans–stilbene, 4,4'-Dimethyl-trans-stilbene, >99.0%(GC), 4,4′-Dimethyl-trans-stilbene 99+%, 4,4′-Dimethyl-trans-stilbene 98%, (E)-1,2-Di-p-tolylethene, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 250mg, 100mg.
1-methyl-4-[(E)-2-(4-methylphenyl)ethenyl]benzene (CAS 18869-29-9) is a chemical compound with the molecular formula C16H16 and a molecular weight of 208.30 g/mol. IUPAC name: 1-methyl-4-[(E)-2-(4-methylphenyl)ethenyl]benzene. InChIKey: KINZBJFIDFZQCB-VAWYXSNFSA-N.
| Molecular formula | C16H16 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | 1-methyl-4-[(E)-2-(4-methylphenyl)ethenyl]benzene |
| InChIKey | KINZBJFIDFZQCB-VAWYXSNFSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)