CAS 188707-40-6 is the registry number for IQO-X1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-6-[2-(methylamino)ethylamino]indeno[2,1-c]quinolin-7-one (CAS 188707-40-6) is a chemical compound with the molecular formula C19H17N3O2 and a molecular weight of 319.4 g/mol. IUPAC name: 3-hydroxy-6-[2-(methylamino)ethylamino]indeno[2,1-c]quinolin-7-one. InChIKey: JFKGWHNEUGCQGI-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 3-hydroxy-6-[2-(methylamino)ethylamino]indeno[2,1-c]quinolin-7-one |
| InChIKey | JFKGWHNEUGCQGI-UHFFFAOYSA-N |
| SMILES | CNCCNC1=NC2=C(C=CC(=C2)O)C3=C1C(=O)C4=CC=CC=C43 |
Computed by PubChem (NCBI)