Products 188814-26-8
CAS 188814-26-8 is the registry number for 3-(3,5-Dichlorophenyl)-3-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3,5-dichlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 188814-26-8) is a chemical compound with the molecular formula C24H19Cl2NO4 and a molecular weight of 456.3 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: BEKZHTVXEZMGPB-UHFFFAOYSA-N.
| Molecular formula | C24H19Cl2NO4 |
|---|---|
| Molecular weight | 456.3 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | BEKZHTVXEZMGPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC(=CC(=C4)Cl)Cl |
Computed by PubChem (NCBI)