CAS 1889290-54-3 is the registry number for (R)-5'-Bromo-2',3'-dihydrospiro[imidazolidine-4,1'-indene]-2,5-dione, 97%. Offered by: Fluorochem. Available pack sizes: 25mg, 50mg, 100mg.
(3R)-6-bromospiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (CAS 1889290-54-3) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: (3R)-6-bromospiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione. InChIKey: VSAYNERGILLODM-LLVKDONJSA-N.
| Molecular formula | C11H9BrN2O2 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | (3R)-6-bromospiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| InChIKey | VSAYNERGILLODM-LLVKDONJSA-N |
| SMILES | C1C[C@@]2(C3=C1C=C(C=C3)Br)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)