CAS 2276548-05-9 is the registry number for Methyl (R)-2-amino-3-(4,4-difluorocyclohexyl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoate (CAS 2276548-05-9) is a chemical compound with the molecular formula C10H17F2NO2 and a molecular weight of 221.24 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoate. InChIKey: XEVWWKZHDROVTG-MRVPVSSYSA-N.
| Molecular formula | C10H17F2NO2 |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoate |
| InChIKey | XEVWWKZHDROVTG-MRVPVSSYSA-N |
| SMILES | COC(=O)[C@@H](CC1CCC(CC1)(F)F)N |
Computed by PubChem (NCBI)