CAS 1890805-01-2 is the registry number for 4-(1-Carboxy-1-methyl-ethoxy)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-methoxycarbonylphenoxy)-2-methylpropanoic acid (CAS 1890805-01-2) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 2-(4-methoxycarbonylphenoxy)-2-methylpropanoic acid. InChIKey: AXAADNZMISUBTR-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(4-methoxycarbonylphenoxy)-2-methylpropanoic acid |
| InChIKey | AXAADNZMISUBTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)