Products 1891085-32-7
CAS 1891085-32-7 is the registry number for 7-(4-Carboxyphenyl)Quinoline-3-Carboxylic Acid, 97%. Offered by: Chemat. Available pack sizes: 100mg.
7-(4-carboxyphenyl)quinoline-3-carboxylic acid (CAS 1891085-32-7) is a chemical compound with the molecular formula C17H11NO4 and a molecular weight of 293.27 g/mol. IUPAC name: 7-(4-carboxyphenyl)quinoline-3-carboxylic acid. InChIKey: MLIKADMORVDSFB-UHFFFAOYSA-N.
| Molecular formula | C17H11NO4 |
|---|---|
| Molecular weight | 293.27 g/mol |
| IUPAC name | 7-(4-carboxyphenyl)quinoline-3-carboxylic acid |
| InChIKey | MLIKADMORVDSFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=NC=C(C=C3C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)