CAS 1891730-11-2 is the registry number for ethyl 2-(2,4-difluoro-3-methoxyphenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-(2,4-difluoro-3-methoxyphenyl)-2-oxoacetate (CAS 1891730-11-2) is a chemical compound with the molecular formula C11H10F2O4 and a molecular weight of 244.19 g/mol. IUPAC name: ethyl 2-(2,4-difluoro-3-methoxyphenyl)-2-oxoacetate. InChIKey: JGZXNMCQXVHHBU-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O4 |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | ethyl 2-(2,4-difluoro-3-methoxyphenyl)-2-oxoacetate |
| InChIKey | JGZXNMCQXVHHBU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C(=C(C=C1)F)OC)F |
Computed by PubChem (NCBI)