Products 2918964-06-2
CAS 2918964-06-2 is the registry number for 2,4-difluoro-5-formyl-3-isopropoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-difluoro-5-formyl-3-propan-2-yloxybenzoic acid (CAS 2918964-06-2) is a chemical compound with the molecular formula C11H10F2O4 and a molecular weight of 244.19 g/mol. IUPAC name: 2,4-difluoro-5-formyl-3-propan-2-yloxybenzoic acid. InChIKey: JBDCGFZNEHJENN-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O4 |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | 2,4-difluoro-5-formyl-3-propan-2-yloxybenzoic acid |
| InChIKey | JBDCGFZNEHJENN-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=CC(=C1F)C(=O)O)C=O)F |
Computed by PubChem (NCBI)