Products 1891734-42-1
CAS 1891734-42-1 is the registry number for 3-(2,2-Difluorobenzo[d][1,3]dioxol-4-yl)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-methylpropanoic acid (CAS 1891734-42-1) is a chemical compound with the molecular formula C11H10F2O4 and a molecular weight of 244.19 g/mol. IUPAC name: 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-methylpropanoic acid. InChIKey: LCMNNAXXPKVGGB-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O4 |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | 3-(2,2-difluoro-1,3-benzodioxol-4-yl)-2-methylpropanoic acid |
| InChIKey | LCMNNAXXPKVGGB-UHFFFAOYSA-N |
| SMILES | CC(CC1=C2C(=CC=C1)OC(O2)(F)F)C(=O)O |
Computed by PubChem (NCBI)