CAS 324579-78-4 is the registry number for 4-(Difluoromethoxy)-3-methoxycinnamic acid, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg.
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoic acid (CAS 324579-78-4) is a chemical compound with the molecular formula C11H10F2O4 and a molecular weight of 244.19 g/mol. IUPAC name: (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoic acid. InChIKey: WLTUXAUWAGSABF-HWKANZROSA-N.
| Molecular formula | C11H10F2O4 |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoic acid |
| InChIKey | WLTUXAUWAGSABF-HWKANZROSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)O)OC(F)F |
Computed by PubChem (NCBI)